C17H26BrN — CID 80673272
N-(2-bromoethyl)-N-[(3,5-dimethylphenyl)methyl]cyclohexanamine (PubChem CID 80673272) has the molecular formula C17H26BrN and a molecular weight of 324.31 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(3,5-dimethylphenyl)methyl]cyclohexanamine.
| Compound Name | N-(2-bromoethyl)-N-[(3,5-dimethylphenyl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 80673272 |
| Molecular Formula | C17H26BrN |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-(2-bromoethyl)-N-[(3,5-dimethylphenyl)methyl]cyclohexanamine |
| SMILES | Cc1cc(C)cc(CN(CCBr)C2CCCCC2)c1 |
| InChI | InChI=1S/C17H26BrN/c1-14-10-15(2)12-16(11-14)13-19(9-8-18)17-6-4-3-5-7-17/h10-12,17H,3-9,13H2,1-2H3 |
| InChIKey | LDAPEBOHHIZQJN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|