C19H12Cl2N2O3S — CID 6083944
[4-[(Z)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 6083944) has the molecular formula C19H12Cl2N2O3S and a molecular weight of 419.29 g/mol. Its IUPAC name is [4-[(Z)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6083944 |
| Molecular Formula | C19H12Cl2N2O3S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | [4-[(Z)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc(/C=N\NC(=O)c2ccc(Cl)cc2Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C19H12Cl2N2O3S/c20-13-5-8-15(16(21)10-13)18(24)23-22-11-12-3-6-14(7-4-12)26-19(25)17-2-1-9-27-17/h1-11H,(H,23,24)/b22-11- |
| InChIKey | BQROBGCSPYBVQB-JJFYIABZSA-N |
| XLogP | 5.04 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|