C18H13N3O3S — CID 1356844
[4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] thiophene-2-carboxylate (PubChem CID 1356844) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1356844 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] thiophene-2-carboxylate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2cccs2)cc1)c1ccccn1 |
| InChI | InChI=1S/C18H13N3O3S/c22-17(15-4-1-2-10-19-15)21-20-12-13-6-8-14(9-7-13)24-18(23)16-5-3-11-25-16/h1-12H,(H,21,22) |
| InChIKey | WQSAYGRDJIQWIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|