About [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate
[4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate (PubChem CID 1369263) has the molecular formula C20H14FN3O3
and a molecular weight of 363.35 g/mol. Its IUPAC name is [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate.
Molecular Properties
| Compound Name | [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate |
| PubChem CID | 1369263 |
| Molecular Formula | C20H14FN3O3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=O)c2ccccn2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H14FN3O3/c21-16-5-3-4-15(12-16)20(26)27-17-9-7-14(8-10-17)13-23-24-19(25)18-6-1-2-11-22-18/h1-13H,(H,24,25) |
| InChIKey | SANYQGILAFMDKB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate?
The IUPAC name of [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate (CID 1369263) is [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate.
What is the SMILES notation for [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate?
The canonical SMILES for [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate is O=C(Oc1ccc(C=NNC(=O)c2ccccn2)cc1)c1cccc(F)c1.
What is the InChIKey of [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate?
The InChIKey is SANYQGILAFMDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FN3O3/c21-16-5-3-4-15(12-16)20(26)27-17-9-7-14(8-10-17)13-23-24-19(25)18-6-1-2-11-22-18/h1-13H,(H,24,25).
What are the key properties of [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate?
[4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate has a molecular weight of 363.35 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(pyridine-2-carbonylhydrazinylidene)methyl]phenyl] 3-fluorobenzoate is sourced from PubChem (CID 1369263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).