3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid

C9H15N3O3 — CID 60840191

IUPAC3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid
SMILESCC(C)N(CCC(=O)O)Cc1ncon1
InChIInChI=1S/C9H15N3O3/c1-7(2)12(4-3-9(13)14)5-8-10-6-15-11-8/h6-7H,3-5H2,1-2H3,(H,13,14)
InChIKeyTYVVCKLHZCXZPS-UHFFFAOYSA-N
MW213.24 g/mol
LogP0.75
Rot. Bonds6

About 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid

3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid (PubChem CID 60840191) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid.

Molecular Properties

Compound Name3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid
PubChem CID60840191
Molecular FormulaC9H15N3O3
Molecular Weight213.24 g/mol
Exact Mass213.11
IUPAC Name3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid
SMILESCC(C)N(CCC(=O)O)Cc1ncon1
InChIInChI=1S/C9H15N3O3/c1-7(2)12(4-3-9(13)14)5-8-10-6-15-11-8/h6-7H,3-5H2,1-2H3,(H,13,14)
InChIKeyTYVVCKLHZCXZPS-UHFFFAOYSA-N
XLogP0.75
TPSA79.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.24
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid?
The IUPAC name of 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid (CID 60840191) is 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid.
What is the SMILES notation for 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid?
The canonical SMILES for 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid is CC(C)N(CCC(=O)O)Cc1ncon1.
What is the InChIKey of 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid?
The InChIKey is TYVVCKLHZCXZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-7(2)12(4-3-9(13)14)5-8-10-6-15-11-8/h6-7H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid?
3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid has a molecular weight of 213.24 g/mol, XLogP of 0.75, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,2,4-oxadiazol-3-ylmethyl(propan-2-yl)amino]propanoic acid is sourced from PubChem (CID 60840191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).