C6H9N3O3 — CID 43466754
3-(1,2,4-oxadiazol-3-ylmethylamino)propanoic acid (PubChem CID 43466754) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 3-(1,2,4-oxadiazol-3-ylmethylamino)propanoic acid.
| Compound Name | 3-(1,2,4-oxadiazol-3-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 43466754 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 3-(1,2,4-oxadiazol-3-ylmethylamino)propanoic acid |
| SMILES | O=C(O)CCNCc1ncon1 |
| InChI | InChI=1S/C6H9N3O3/c10-6(11)1-2-7-3-5-8-4-12-9-5/h4,7H,1-3H2,(H,10,11) |
| InChIKey | GQVYZNVHOZDRIQ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|