C5H7N3O3 — CID 43466222
2-(1,2,4-oxadiazol-3-ylmethylamino)acetic acid (PubChem CID 43466222) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-3-ylmethylamino)acetic acid.
| Compound Name | 2-(1,2,4-oxadiazol-3-ylmethylamino)acetic acid |
|---|---|
| PubChem CID | 43466222 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 2-(1,2,4-oxadiazol-3-ylmethylamino)acetic acid |
| SMILES | O=C(O)CNCc1ncon1 |
| InChI | InChI=1S/C5H7N3O3/c9-5(10)2-6-1-4-7-3-11-8-4/h3,6H,1-2H2,(H,9,10) |
| InChIKey | SXBOGYYHLVWDQG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |