C13H15N3O2S — CID 60840198
2-[cyclopentyl(thieno[2,3-d]pyrimidin-4-yl)amino]acetic acid (PubChem CID 60840198) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[cyclopentyl(thieno[2,3-d]pyrimidin-4-yl)amino]acetic acid.
| Compound Name | 2-[cyclopentyl(thieno[2,3-d]pyrimidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 60840198 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[cyclopentyl(thieno[2,3-d]pyrimidin-4-yl)amino]acetic acid |
| SMILES | O=C(O)CN(c1ncnc2sccc12)C1CCCC1 |
| InChI | InChI=1S/C13H15N3O2S/c17-11(18)7-16(9-3-1-2-4-9)12-10-5-6-19-13(10)15-8-14-12/h5-6,8-9H,1-4,7H2,(H,17,18) |
| InChIKey | WVZKMZBWGQIIEC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |