C15H17ClN2O2 — CID 60840202
2-[butan-2-yl-(7-chloroquinolin-4-yl)amino]acetic acid (PubChem CID 60840202) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-[butan-2-yl-(7-chloroquinolin-4-yl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl-(7-chloroquinolin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 60840202 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-[butan-2-yl-(7-chloroquinolin-4-yl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H17ClN2O2/c1-3-10(2)18(9-15(19)20)14-6-7-17-13-8-11(16)4-5-12(13)14/h4-8,10H,3,9H2,1-2H3,(H,19,20) |
| InChIKey | OQCBNWPTFRGEFM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |