About 1,1-dipentoxysilolane
1,1-dipentoxysilolane (PubChem CID 608427) has the molecular formula C14H30O2Si
and a molecular weight of 258.48 g/mol. Its IUPAC name is 1,1-dipentoxysilolane.
Molecular Properties
| Compound Name | 1,1-dipentoxysilolane |
| PubChem CID | 608427 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1,1-dipentoxysilolane |
| SMILES | CCCCCO[Si]1(OCCCCC)CCCC1 |
| InChI | InChI=1S/C14H30O2Si/c1-3-5-7-11-15-17(13-9-10-14-17)16-12-8-6-4-2/h3-14H2,1-2H3 |
| InChIKey | KHDUXVLUWWFLEK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipentoxysilolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipentoxysilolane?
The IUPAC name of 1,1-dipentoxysilolane (CID 608427) is 1,1-dipentoxysilolane.
What is the SMILES notation for 1,1-dipentoxysilolane?
The canonical SMILES for 1,1-dipentoxysilolane is CCCCCO[Si]1(OCCCCC)CCCC1.
What is the InChIKey of 1,1-dipentoxysilolane?
The InChIKey is KHDUXVLUWWFLEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2Si/c1-3-5-7-11-15-17(13-9-10-14-17)16-12-8-6-4-2/h3-14H2,1-2H3.
What are the key properties of 1,1-dipentoxysilolane?
1,1-dipentoxysilolane has a molecular weight of 258.48 g/mol, XLogP of 4.64, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipentoxysilolane is sourced from PubChem (CID 608427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).