About 1-ethyl-1-octoxysilinane
1-ethyl-1-octoxysilinane (PubChem CID 614794) has the molecular formula C15H32OSi
and a molecular weight of 256.51 g/mol. Its IUPAC name is 1-ethyl-1-octoxysilinane.
Molecular Properties
| Compound Name | 1-ethyl-1-octoxysilinane |
| PubChem CID | 614794 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-ethyl-1-octoxysilinane |
| SMILES | CCCCCCCCO[Si]1(CC)CCCCC1 |
| InChI | InChI=1S/C15H32OSi/c1-3-5-6-7-8-10-13-16-17(4-2)14-11-9-12-15-17/h3-15H2,1-2H3 |
| InChIKey | YQSHFZIVXXONRV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-octoxysilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-octoxysilinane?
The IUPAC name of 1-ethyl-1-octoxysilinane (CID 614794) is 1-ethyl-1-octoxysilinane.
What is the SMILES notation for 1-ethyl-1-octoxysilinane?
The canonical SMILES for 1-ethyl-1-octoxysilinane is CCCCCCCCO[Si]1(CC)CCCCC1.
What is the InChIKey of 1-ethyl-1-octoxysilinane?
The InChIKey is YQSHFZIVXXONRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32OSi/c1-3-5-6-7-8-10-13-16-17(4-2)14-11-9-12-15-17/h3-15H2,1-2H3.
What are the key properties of 1-ethyl-1-octoxysilinane?
1-ethyl-1-octoxysilinane has a molecular weight of 256.51 g/mol, XLogP of 5.51, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-octoxysilinane is sourced from PubChem (CID 614794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).