C14H18Cl2N2O2S — CID 60845685
4-(3-aminoprop-1-ynyl)-2,6-dichloro-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 60845685) has the molecular formula C14H18Cl2N2O2S and a molecular weight of 349.28 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-2,6-dichloro-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-2,6-dichloro-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60845685 |
| Molecular Formula | C14H18Cl2N2O2S |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-2,6-dichloro-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | CC(C)CCNS(=O)(=O)c1c(Cl)cc(C#CCN)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O2S/c1-10(2)5-7-18-21(19,20)14-12(15)8-11(4-3-6-17)9-13(14)16/h8-10,18H,5-7,17H2,1-2H3 |
| InChIKey | HFIWAIJQCADBDH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|