C11H15N3O4S — CID 60849783
2-amino-N-[2-(2-methylsulfonylanilino)-2-oxoethyl]acetamide (PubChem CID 60849783) has the molecular formula C11H15N3O4S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-amino-N-[2-(2-methylsulfonylanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-(2-methylsulfonylanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60849783 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-amino-N-[2-(2-methylsulfonylanilino)-2-oxoethyl]acetamide |
| SMILES | CS(=O)(=O)c1ccccc1NC(=O)CNC(=O)CN |
| InChI | InChI=1S/C11H15N3O4S/c1-19(17,18)9-5-3-2-4-8(9)14-11(16)7-13-10(15)6-12/h2-5H,6-7,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | SZIRQWHRPFHVNX-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |