C13H16Cl2N4OS — CID 60851320
N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-4-(propan-2-ylamino)butanamide (PubChem CID 60851320) has the molecular formula C13H16Cl2N4OS and a molecular weight of 347.27 g/mol. Its IUPAC name is N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-4-(propan-2-ylamino)butanamide.
| Compound Name | N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 60851320 |
| Molecular Formula | C13H16Cl2N4OS |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-4-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NCCCC(=O)Nc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C13H16Cl2N4OS/c1-7(2)16-5-3-4-10(20)17-11-8(14)6-9(15)12-13(11)19-21-18-12/h6-7,16H,3-5H2,1-2H3,(H,17,20) |
| InChIKey | JIYIAIJXCRXOGZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|