C8H15F3N2O2 — CID 60858888
2,2,2-trifluoroethyl N-[2-(dimethylamino)propyl]carbamate (PubChem CID 60858888) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-(dimethylamino)propyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 60858888 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-(dimethylamino)propyl]carbamate |
| SMILES | CC(CNC(=O)OCC(F)(F)F)N(C)C |
| InChI | InChI=1S/C8H15F3N2O2/c1-6(13(2)3)4-12-7(14)15-5-8(9,10)11/h6H,4-5H2,1-3H3,(H,12,14) |
| InChIKey | JRIRHXPWPGBMAQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |