C8H14F3NO3 — CID 62734847
2,2,2-trifluoroethyl N-(2-hydroxy-2-methylbutyl)carbamate (PubChem CID 62734847) has the molecular formula C8H14F3NO3 and a molecular weight of 229.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2-hydroxy-2-methylbutyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2-hydroxy-2-methylbutyl)carbamate |
|---|---|
| PubChem CID | 62734847 |
| Molecular Formula | C8H14F3NO3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2-hydroxy-2-methylbutyl)carbamate |
| SMILES | CCC(C)(O)CNC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO3/c1-3-7(2,14)4-12-6(13)15-5-8(9,10)11/h14H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | OWTAMWRVMQAVPO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |