C11H9NO5S — CID 60873833
3-(1,2-oxazol-4-ylmethylsulfonyl)benzoic acid (PubChem CID 60873833) has the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. Its IUPAC name is 3-(1,2-oxazol-4-ylmethylsulfonyl)benzoic acid.
| Compound Name | 3-(1,2-oxazol-4-ylmethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 60873833 |
| Molecular Formula | C11H9NO5S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 3-(1,2-oxazol-4-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)Cc2cnoc2)c1 |
| InChI | InChI=1S/C11H9NO5S/c13-11(14)9-2-1-3-10(4-9)18(15,16)7-8-5-12-17-6-8/h1-6H,7H2,(H,13,14) |
| InChIKey | SVVWFBXZISENLP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |