C10H18N4O — CID 60874037
N-(3-aminopropyl)-N-methyl-2-(4-methylpyrazol-1-yl)acetamide (PubChem CID 60874037) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-2-(4-methylpyrazol-1-yl)acetamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-2-(4-methylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 60874037 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-2-(4-methylpyrazol-1-yl)acetamide |
| SMILES | Cc1cnn(CC(=O)N(C)CCCN)c1 |
| InChI | InChI=1S/C10H18N4O/c1-9-6-12-14(7-9)8-10(15)13(2)5-3-4-11/h6-7H,3-5,8,11H2,1-2H3 |
| InChIKey | HPADEIISWHYVRH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |