C15H21FN2 — CID 60874806
3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-fluoroaniline (PubChem CID 60874806) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-fluoroaniline.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 60874806 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-fluoroaniline |
| SMILES | Nc1cc(F)cc(N2CCCC3CCCCC32)c1 |
| InChI | InChI=1S/C15H21FN2/c16-12-8-13(17)10-14(9-12)18-7-3-5-11-4-1-2-6-15(11)18/h8-11,15H,1-7,17H2 |
| InChIKey | FLRPCZIKXSGXHT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|