C9H13N3 — CID 60875096
1-N-(6-methyl-2-pyridinyl)cyclopropane-1,2-diamine (PubChem CID 60875096) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-N-(6-methyl-2-pyridinyl)cyclopropane-1,2-diamine.
| Compound Name | 1-N-(6-methyl-2-pyridinyl)cyclopropane-1,2-diamine |
|---|---|
| PubChem CID | 60875096 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1-N-(6-methyl-2-pyridinyl)cyclopropane-1,2-diamine |
| SMILES | Cc1cccc(NC2CC2N)n1 |
| InChI | InChI=1S/C9H13N3/c1-6-3-2-4-9(11-6)12-8-5-7(8)10/h2-4,7-8H,5,10H2,1H3,(H,11,12) |
| InChIKey | GCVMGVYAIWEDHN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |