C16H23NO2 — CID 60881839
N-[(4-but-3-ynoxy-3-ethoxyphenyl)methyl]propan-1-amine (PubChem CID 60881839) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-[(4-but-3-ynoxy-3-ethoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(4-but-3-ynoxy-3-ethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 60881839 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(4-but-3-ynoxy-3-ethoxyphenyl)methyl]propan-1-amine |
| SMILES | C#CCCOc1ccc(CNCCC)cc1OCC |
| InChI | InChI=1S/C16H23NO2/c1-4-7-11-19-15-9-8-14(13-17-10-5-2)12-16(15)18-6-3/h1,8-9,12,17H,5-7,10-11,13H2,2-3H3 |
| InChIKey | DVBYHOWSYFUDTM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|