C16H11ClF2N2O — CID 6088566
2-[(Z)-1-chloro-2-[2-(difluoromethoxy)phenyl]ethenyl]-1H-benzimidazole (PubChem CID 6088566) has the molecular formula C16H11ClF2N2O and a molecular weight of 320.73 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-[2-(difluoromethoxy)phenyl]ethenyl]-1H-benzimidazole.
| Compound Name | 2-[(Z)-1-chloro-2-[2-(difluoromethoxy)phenyl]ethenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 6088566 |
| Molecular Formula | C16H11ClF2N2O |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[(Z)-1-chloro-2-[2-(difluoromethoxy)phenyl]ethenyl]-1H-benzimidazole |
| SMILES | FC(F)Oc1ccccc1/C=C(\Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H11ClF2N2O/c17-11(15-20-12-6-2-3-7-13(12)21-15)9-10-5-1-4-8-14(10)22-16(18)19/h1-9,16H,(H,20,21)/b11-9- |
| InChIKey | WDHGIDORPBDDQB-LUAWRHEFSA-N |
| XLogP | 4.90 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |