C10H15FN2 — CID 60887762
N'-[1-(4-fluorophenyl)ethyl]ethane-1,2-diamine (PubChem CID 60887762) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[1-(4-fluorophenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60887762 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N'-[1-(4-fluorophenyl)ethyl]ethane-1,2-diamine |
| SMILES | CC(NCCN)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H15FN2/c1-8(13-7-6-12)9-2-4-10(11)5-3-9/h2-5,8,13H,6-7,12H2,1H3 |
| InChIKey | KTQRNHBHLYKGOE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |