C14H21NO5S — CID 60888034
4-[2-(aminomethyl)-5-propoxyphenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 60888034) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-5-propoxyphenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[2-(aminomethyl)-5-propoxyphenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60888034 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-[2-(aminomethyl)-5-propoxyphenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | CCCOc1ccc(CN)c(OC2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C14H21NO5S/c1-2-5-19-11-4-3-10(7-15)13(6-11)20-14-9-21(17,18)8-12(14)16/h3-4,6,12,14,16H,2,5,7-9,15H2,1H3 |
| InChIKey | WAKLDXIIRQAUQQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |