C7H14F3N3O — CID 60890616
N'-hydroxy-4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide (PubChem CID 60890616) has the molecular formula C7H14F3N3O and a molecular weight of 213.20 g/mol. Its IUPAC name is N'-hydroxy-4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide.
| Compound Name | N'-hydroxy-4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide |
|---|---|
| PubChem CID | 60890616 |
| Molecular Formula | C7H14F3N3O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | N'-hydroxy-4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide |
| SMILES | CN(CCC/C(N)=N/O)CC(F)(F)F |
| InChI | InChI=1S/C7H14F3N3O/c1-13(5-7(8,9)10)4-2-3-6(11)12-14/h14H,2-5H2,1H3,(H2,11,12) |
| InChIKey | JURUNAHJJRFBNM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|