C9H9Cl2F3N2O2S — CID 60891162
2-amino-4,6-dichloro-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60891162) has the molecular formula C9H9Cl2F3N2O2S and a molecular weight of 337.15 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60891162 |
| Molecular Formula | C9H9Cl2F3N2O2S |
| Molecular Weight | 337.15 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 2-amino-4,6-dichloro-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2F3N2O2S/c1-16(4-9(12,13)14)19(17,18)8-6(11)2-5(10)3-7(8)15/h2-3H,4,15H2,1H3 |
| InChIKey | DHZNSVHWYLVPCW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|