C8H15F3N2S — CID 60891383
3-[methyl(2,2,2-trifluoroethyl)amino]pentanethioamide (PubChem CID 60891383) has the molecular formula C8H15F3N2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 3-[methyl(2,2,2-trifluoroethyl)amino]pentanethioamide.
| Compound Name | 3-[methyl(2,2,2-trifluoroethyl)amino]pentanethioamide |
|---|---|
| PubChem CID | 60891383 |
| Molecular Formula | C8H15F3N2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-[methyl(2,2,2-trifluoroethyl)amino]pentanethioamide |
| SMILES | CCC(CC(N)=S)N(C)CC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2S/c1-3-6(4-7(12)14)13(2)5-8(9,10)11/h6H,3-5H2,1-2H3,(H2,12,14) |
| InChIKey | NWCGEEJJJKENBB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|