C13H12F3N3O2 — CID 60891595
(E)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid (PubChem CID 60891595) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is (E)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 60891595 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (E)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid |
| SMILES | CN(CC(F)(F)F)c1nc2ccccn2c1/C=C/C(=O)O |
| InChI | InChI=1S/C13H12F3N3O2/c1-18(8-13(14,15)16)12-9(5-6-11(20)21)19-7-3-2-4-10(19)17-12/h2-7H,8H2,1H3,(H,20,21)/b6-5+ |
| InChIKey | OLMCCCDZQACBOR-AATRIKPKSA-N |
| XLogP | 2.43 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|