C13H20FNO3 — CID 60897562
1-(2-ethoxyethoxy)-3-(3-fluoroanilino)propan-2-ol (PubChem CID 60897562) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-(2-ethoxyethoxy)-3-(3-fluoroanilino)propan-2-ol.
| Compound Name | 1-(2-ethoxyethoxy)-3-(3-fluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 60897562 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(2-ethoxyethoxy)-3-(3-fluoroanilino)propan-2-ol |
| SMILES | CCOCCOCC(O)CNc1cccc(F)c1 |
| InChI | InChI=1S/C13H20FNO3/c1-2-17-6-7-18-10-13(16)9-15-12-5-3-4-11(14)8-12/h3-5,8,13,15-16H,2,6-7,9-10H2,1H3 |
| InChIKey | QSUATXLJCMPTHW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|