C15H24INO3 — CID 60900613
1-(2-butoxyethoxy)-3-(3-iodoanilino)propan-2-ol (PubChem CID 60900613) has the molecular formula C15H24INO3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-(2-butoxyethoxy)-3-(3-iodoanilino)propan-2-ol.
| Compound Name | 1-(2-butoxyethoxy)-3-(3-iodoanilino)propan-2-ol |
|---|---|
| PubChem CID | 60900613 |
| Molecular Formula | C15H24INO3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1-(2-butoxyethoxy)-3-(3-iodoanilino)propan-2-ol |
| SMILES | CCCCOCCOCC(O)CNc1cccc(I)c1 |
| InChI | InChI=1S/C15H24INO3/c1-2-3-7-19-8-9-20-12-15(18)11-17-14-6-4-5-13(16)10-14/h4-6,10,15,17-18H,2-3,7-9,11-12H2,1H3 |
| InChIKey | DCJOUYAAPLLTEQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|