C15H25NO3 — CID 60898599
1-(4-ethoxyanilino)-3-[(2-methylpropan-2-yl)oxy]propan-2-ol (PubChem CID 60898599) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-(4-ethoxyanilino)-3-[(2-methylpropan-2-yl)oxy]propan-2-ol.
| Compound Name | 1-(4-ethoxyanilino)-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 60898599 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(4-ethoxyanilino)-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
| SMILES | CCOc1ccc(NCC(O)COC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25NO3/c1-5-18-14-8-6-12(7-9-14)16-10-13(17)11-19-15(2,3)4/h6-9,13,16-17H,5,10-11H2,1-4H3 |
| InChIKey | HUGFSRJISMVFLS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|