C15H14ClF2NO2 — CID 60898768
1-(2-chlorophenoxy)-3-(3,4-difluoroanilino)propan-2-ol (PubChem CID 60898768) has the molecular formula C15H14ClF2NO2 and a molecular weight of 313.73 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)-3-(3,4-difluoroanilino)propan-2-ol.
| Compound Name | 1-(2-chlorophenoxy)-3-(3,4-difluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 60898768 |
| Molecular Formula | C15H14ClF2NO2 |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-(2-chlorophenoxy)-3-(3,4-difluoroanilino)propan-2-ol |
| SMILES | OC(CNc1ccc(F)c(F)c1)COc1ccccc1Cl |
| InChI | InChI=1S/C15H14ClF2NO2/c16-12-3-1-2-4-15(12)21-9-11(20)8-19-10-5-6-13(17)14(18)7-10/h1-7,11,19-20H,8-9H2 |
| InChIKey | AWCKLGSHNMQDKH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |