C12H18N4O — CID 60904196
1-[2-(2-pyridin-4-ylethylamino)ethyl]imidazolidin-2-one (PubChem CID 60904196) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[2-(2-pyridin-4-ylethylamino)ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-(2-pyridin-4-ylethylamino)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 60904196 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[2-(2-pyridin-4-ylethylamino)ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNCCc1ccncc1 |
| InChI | InChI=1S/C12H18N4O/c17-12-15-8-10-16(12)9-7-14-6-3-11-1-4-13-5-2-11/h1-2,4-5,14H,3,6-10H2,(H,15,17) |
| InChIKey | ODNJMAKTXFJRDY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|