C8H13N5O2 — CID 106399247
1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]imidazolidin-2-one (PubChem CID 106399247) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 106399247 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-[2-(1,2,4-oxadiazol-3-ylmethylamino)ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNCc1ncon1 |
| InChI | InChI=1S/C8H13N5O2/c14-8-10-2-4-13(8)3-1-9-5-7-11-6-15-12-7/h6,9H,1-5H2,(H,10,14) |
| InChIKey | FLPPIPWAJGMUAZ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|