C16H22N4O — CID 60905479
5-amino-N-(2,3-dimethylcyclohexyl)-1H-indazole-3-carboxamide (PubChem CID 60905479) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-amino-N-(2,3-dimethylcyclohexyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-amino-N-(2,3-dimethylcyclohexyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 60905479 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-amino-N-(2,3-dimethylcyclohexyl)-1H-indazole-3-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2n[nH]c3ccc(N)cc23)C1C |
| InChI | InChI=1S/C16H22N4O/c1-9-4-3-5-13(10(9)2)18-16(21)15-12-8-11(17)6-7-14(12)19-20-15/h6-10,13H,3-5,17H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | TUQQAJYICDXWBU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|