C18H22ClNO — CID 60906504
2-chloro-1-[2,5-dimethyl-1-(3-phenylpropyl)pyrrol-3-yl]propan-1-one (PubChem CID 60906504) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is 2-chloro-1-[2,5-dimethyl-1-(3-phenylpropyl)pyrrol-3-yl]propan-1-one.
| Compound Name | 2-chloro-1-[2,5-dimethyl-1-(3-phenylpropyl)pyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 60906504 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-chloro-1-[2,5-dimethyl-1-(3-phenylpropyl)pyrrol-3-yl]propan-1-one |
| SMILES | Cc1cc(C(=O)C(C)Cl)c(C)n1CCCc1ccccc1 |
| InChI | InChI=1S/C18H22ClNO/c1-13-12-17(18(21)14(2)19)15(3)20(13)11-7-10-16-8-5-4-6-9-16/h4-6,8-9,12,14H,7,10-11H2,1-3H3 |
| InChIKey | GKFDNBLBDRHALV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|