C12H17ClN2O3 — CID 83203189
2-[3-(2-chloropropanoyl)-2,5-dimethylpyrrol-1-yl]ethyl carbamate (PubChem CID 83203189) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-[3-(2-chloropropanoyl)-2,5-dimethylpyrrol-1-yl]ethyl carbamate.
| Compound Name | 2-[3-(2-chloropropanoyl)-2,5-dimethylpyrrol-1-yl]ethyl carbamate |
|---|---|
| PubChem CID | 83203189 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[3-(2-chloropropanoyl)-2,5-dimethylpyrrol-1-yl]ethyl carbamate |
| SMILES | Cc1cc(C(=O)C(C)Cl)c(C)n1CCOC(N)=O |
| InChI | InChI=1S/C12H17ClN2O3/c1-7-6-10(11(16)8(2)13)9(3)15(7)4-5-18-12(14)17/h6,8H,4-5H2,1-3H3,(H2,14,17) |
| InChIKey | OEILOWMUMWALEJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|