C17H27ClN2O — CID 107164891
2-chloro-1-[1-[(1,4-dimethylpiperidin-4-yl)methyl]-2,5-dimethylpyrrol-3-yl]propan-1-one (PubChem CID 107164891) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 2-chloro-1-[1-[(1,4-dimethylpiperidin-4-yl)methyl]-2,5-dimethylpyrrol-3-yl]propan-1-one.
| Compound Name | 2-chloro-1-[1-[(1,4-dimethylpiperidin-4-yl)methyl]-2,5-dimethylpyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 107164891 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-chloro-1-[1-[(1,4-dimethylpiperidin-4-yl)methyl]-2,5-dimethylpyrrol-3-yl]propan-1-one |
| SMILES | Cc1cc(C(=O)C(C)Cl)c(C)n1CC1(C)CCN(C)CC1 |
| InChI | InChI=1S/C17H27ClN2O/c1-12-10-15(16(21)13(2)18)14(3)20(12)11-17(4)6-8-19(5)9-7-17/h10,13H,6-9,11H2,1-5H3 |
| InChIKey | IAEXRXPMJOFMGM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|