C13H29NO3 — CID 60909433
2-[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]-2-methylpropan-1-ol (PubChem CID 60909433) has the molecular formula C13H29NO3 and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]-2-methylpropan-1-ol.
| Compound Name | 2-[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 60909433 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 2-[[2-hydroxy-3-(4-methylpentan-2-yloxy)propyl]amino]-2-methylpropan-1-ol |
| SMILES | CC(C)CC(C)OCC(O)CNC(C)(C)CO |
| InChI | InChI=1S/C13H29NO3/c1-10(2)6-11(3)17-8-12(16)7-14-13(4,5)9-15/h10-12,14-16H,6-9H2,1-5H3 |
| InChIKey | DBXZLQDDMFCXDL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |