C15H22FNO4 — CID 60910141
methyl 2-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylbutanoate (PubChem CID 60910141) has the molecular formula C15H22FNO4 and a molecular weight of 299.34 g/mol. Its IUPAC name is methyl 2-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 60910141 |
| Molecular Formula | C15H22FNO4 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methyl 2-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NCC(O)COc1ccccc1F)C(C)C |
| InChI | InChI=1S/C15H22FNO4/c1-10(2)14(15(19)20-3)17-8-11(18)9-21-13-7-5-4-6-12(13)16/h4-7,10-11,14,17-18H,8-9H2,1-3H3 |
| InChIKey | RWMVXEKCJGCQTI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |