C11H13N5O2 — CID 60911192
2-(3-amino-1,2,4-triazol-1-yl)-N-(4-methoxyphenyl)acetamide (PubChem CID 60911192) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 60911192 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2cnc(N)n2)cc1 |
| InChI | InChI=1S/C11H13N5O2/c1-18-9-4-2-8(3-5-9)14-10(17)6-16-7-13-11(12)15-16/h2-5,7H,6H2,1H3,(H2,12,15)(H,14,17) |
| InChIKey | CVELDQNCLAQBPS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |