C12H14N4O2 — CID 55024845
2-(3-aminopyrazol-1-yl)-N-(4-methoxyphenyl)acetamide (PubChem CID 55024845) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55024845 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2ccc(N)n2)cc1 |
| InChI | InChI=1S/C12H14N4O2/c1-18-10-4-2-9(3-5-10)14-12(17)8-16-7-6-11(13)15-16/h2-7H,8H2,1H3,(H2,13,15)(H,14,17) |
| InChIKey | GLBAERHUXCUHEF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |