C13H15ClN4O3 — CID 62102210
2-(3-aminopyrazol-1-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide (PubChem CID 62102210) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-(3-aminopyrazol-1-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(3-aminopyrazol-1-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 62102210 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(3-aminopyrazol-1-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)Cn2ccc(N)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C13H15ClN4O3/c1-20-10-6-9(11(21-2)5-8(10)14)16-13(19)7-18-4-3-12(15)17-18/h3-6H,7H2,1-2H3,(H2,15,17)(H,16,19) |
| InChIKey | BYRHVLVZLKUMRS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |