About 3-(3,5-dimethylpiperidin-1-yl)butanimidamide
3-(3,5-dimethylpiperidin-1-yl)butanimidamide (PubChem CID 60914525) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)butanimidamide.
Molecular Properties
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)butanimidamide |
| PubChem CID | 60914525 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C11H23N3/c1-8-4-9(2)7-14(6-8)10(3)5-11(12)13/h8-10H,4-7H2,1-3H3,(H3,12,13) |
| InChIKey | FUCGTNABPGOTJF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethylpiperidin-1-yl)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylpiperidin-1-yl)butanimidamide?
The IUPAC name of 3-(3,5-dimethylpiperidin-1-yl)butanimidamide (CID 60914525) is 3-(3,5-dimethylpiperidin-1-yl)butanimidamide.
What is the SMILES notation for 3-(3,5-dimethylpiperidin-1-yl)butanimidamide?
The canonical SMILES for 3-(3,5-dimethylpiperidin-1-yl)butanimidamide is [H]/N=C(\N)CC(C)N1CC(C)CC(C)C1.
What is the InChIKey of 3-(3,5-dimethylpiperidin-1-yl)butanimidamide?
The InChIKey is FUCGTNABPGOTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-8-4-9(2)7-14(6-8)10(3)5-11(12)13/h8-10H,4-7H2,1-3H3,(H3,12,13).
What are the key properties of 3-(3,5-dimethylpiperidin-1-yl)butanimidamide?
3-(3,5-dimethylpiperidin-1-yl)butanimidamide has a molecular weight of 197.33 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylpiperidin-1-yl)butanimidamide is sourced from PubChem (CID 60914525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).