About 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide
3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide (PubChem CID 63610753) has the molecular formula C11H24N4
and a molecular weight of 212.34 g/mol. Its IUPAC name is 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide.
Molecular Properties
| Compound Name | 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide |
| PubChem CID | 63610753 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C11H24N4/c1-9(7-10(12)13)15-6-5-14(4)11(2,3)8-15/h9H,5-8H2,1-4H3,(H3,12,13) |
| InChIKey | JWRTUEXHOOVADT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide?
The IUPAC name of 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide (CID 63610753) is 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide.
What is the SMILES notation for 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide?
The canonical SMILES for 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide is [H]/N=C(\N)CC(C)N1CCN(C)C(C)(C)C1.
What is the InChIKey of 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide?
The InChIKey is JWRTUEXHOOVADT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N4/c1-9(7-10(12)13)15-6-5-14(4)11(2,3)8-15/h9H,5-8H2,1-4H3,(H3,12,13).
What are the key properties of 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide?
3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide has a molecular weight of 212.34 g/mol, XLogP of 0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3,4-trimethylpiperazin-1-yl)butanimidamide is sourced from PubChem (CID 63610753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).