C10H21NO4S — CID 60915688
3-[tert-butyl(2-methylsulfonylethyl)amino]propanoic acid (PubChem CID 60915688) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-[tert-butyl(2-methylsulfonylethyl)amino]propanoic acid.
| Compound Name | 3-[tert-butyl(2-methylsulfonylethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 60915688 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[tert-butyl(2-methylsulfonylethyl)amino]propanoic acid |
| SMILES | CC(C)(C)N(CCC(=O)O)CCS(C)(=O)=O |
| InChI | InChI=1S/C10H21NO4S/c1-10(2,3)11(6-5-9(12)13)7-8-16(4,14)15/h5-8H2,1-4H3,(H,12,13) |
| InChIKey | ILWWMXXURQYAFY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |