C5H6F3N3O2S — CID 60916087
N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60916087) has the molecular formula C5H6F3N3O2S and a molecular weight of 229.18 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60916087 |
| Molecular Formula | C5H6F3N3O2S |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)F)c1cn[nH]c1 |
| InChI | InChI=1S/C5H6F3N3O2S/c6-5(7,8)3-11-14(12,13)4-1-9-10-2-4/h1-2,11H,3H2,(H,9,10) |
| InChIKey | GRCIMJYEUZHHGX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |