C13H20ClN — CID 60919276
1-(3-chlorophenyl)-2,3-dimethylpentan-2-amine (PubChem CID 60919276) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,3-dimethylpentan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-2,3-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 60919276 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-(3-chlorophenyl)-2,3-dimethylpentan-2-amine |
| SMILES | CCC(C)C(C)(N)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H20ClN/c1-4-10(2)13(3,15)9-11-6-5-7-12(14)8-11/h5-8,10H,4,9,15H2,1-3H3 |
| InChIKey | DUQQKRLNEDZUTL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |