C12H17NO2 — CID 60920082
1-(2-cyclohexylethyl)pyrrole-2,5-dione (PubChem CID 60920082) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)pyrrole-2,5-dione.
| Compound Name | 1-(2-cyclohexylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 60920082 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-(2-cyclohexylethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCC1CCCCC1 |
| InChI | InChI=1S/C12H17NO2/c14-11-6-7-12(15)13(11)9-8-10-4-2-1-3-5-10/h6-7,10H,1-5,8-9H2 |
| InChIKey | TWFPDALGUPGXCE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|