C11H4F11NO2 — CID 87905786
1-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl]pyrrole-2,5-dione (PubChem CID 87905786) has the molecular formula C11H4F11NO2 and a molecular weight of 391.14 g/mol. Its IUPAC name is 1-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87905786 |
| Molecular Formula | C11H4F11NO2 |
| Molecular Weight | 391.14 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 1-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H4F11NO2/c12-6(3-23-4(24)1-2-5(23)25)7(13,14)9(17,18)11(21,22)10(19,20)8(6,15)16/h1-2H,3H2 |
| InChIKey | QHYGIUYZFRQVKG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|